Recombinant Mouse B7-H3/CD276Protein(C-6His)
Cat No.: ARP4831
Size：
| Product Name: | Recombinant Mouse B7-H3/CD276Protein(C-6His) |
| Cat No.: | ARP4831 |
| source: | HEK293 Cells |
| reactivity: | Mouse |
| applications: | Positive Control; Immunogen; SDS-PAGE; WB |
| target id: | Q8VE98 |
| gene accession number: | 102657 |
| peptide sequence: | Val29-Phe244 |
| predicted molecular mass: | 24.3 kDa |
| tag: | C-6His |
| purity: | >95% as determined by SDS-PAGE. |
| form: | Freeze-dried powder |
| storage buffer: | Phosphate buffered saline (pH7.4) containing 0.01% sarcosyl, 5%Trehalose |
| storage condition: | Aliquot and store at -20℃ to -80℃ for up to 6 months, buffer containing 50% glycerol is recommended |
| category: | Protein |
| stock: | In Stock |
| synonyms: | CD276 antigen; CD276; B7 homolog 3; B7-H3;CD276 |